![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| the biology of alz d..> | 2013-11-01 21:02 | 18M | |
| 02 protein structure..> | 2013-09-13 14:13 | 8.5M | |
| 03 protein folding.ppt | 2013-09-13 14:13 | 7.0M | |
| Development-2013-van..> | 2013-09-13 14:13 | 6.9M | |
| 05-paper.zip | 2013-11-01 10:10 | 5.8M | |
| 05-autophagy.pptx | 2013-11-01 19:01 | 5.3M | |
| 04-proteolysis.ppt | 2013-10-25 14:59 | 3.2M | |
| 06-ApoE4.pptx | 2013-11-15 14:05 | 2.3M | |
| UnravelingtheMystery..> | 2013-09-13 14:13 | 2.1M | |
| 01-Intro.pptx | 2013-09-13 14:12 | 1.5M | |
| treatment and preven..> | 2013-09-13 14:13 | 1.0M | |
| nrn3505.pdf | 2013-09-13 14:13 | 652K | |
| 06-presenilins.pptx | 2013-11-01 10:17 | 606K | |
| S1092852913000023a.pdf | 2013-09-13 14:13 | 495K | |
| 04-proteolysis.pdf | 2013-10-25 10:14 | 373K | |
| nnr120012_304_310.pdf | 2013-09-13 14:13 | 334K | |
| Hum. Mol. Genet.-201..> | 2013-09-13 14:13 | 183K | |
| 1651-1664.pdf | 2013-09-13 14:13 | 137K | |
| role of amyloid beta..> | 2013-09-13 14:13 | 122K | |
| nrneurol.2012.275.pdf | 2013-09-13 14:13 | 87K | |
| nvp120001_772_773.pdf | 2013-09-13 14:13 | 55K | |