![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 09-aging and proteos..> | 2016-11-09 19:08 | 9.4M | |
| 시냅스.pdf | 2010-10-27 08:01 | 4.5M | |
| bchap-03.pdf | 2008-09-16 08:20 | 4.2M | |
| 03 brain development..> | 2016-09-29 08:07 | 3.8M | |
| 02 neuron.pdf | 2015-09-16 10:18 | 3.6M | |
| 041 vision.pdf | 2015-10-26 15:32 | 3.5M | |
| 09-aging and proteos..> | 2016-11-10 07:57 | 3.2M | |
| bchap-11 new diagnos..> | 2010-11-04 08:29 | 3.1M | |
| bchap-5 memory.pdf | 2008-10-07 16:27 | 3.0M | |
| chapter-4.pdf | 2009-09-29 08:20 | 2.8M | |
| bchap-8 stress.pdf | 2012-11-19 15:18 | 2.6M | |
| bchap-41 vision.pdf | 2012-10-16 12:50 | 2.5M | |
| bchap-5-2 learning.pdf | 2010-10-27 08:01 | 2.5M | |
| chapter-2.pdf | 2009-09-16 15:30 | 2.4M | |
| 11 new diagnosis.pdf | 2017-11-22 09:25 | 2.2M | |
| bchap-5-1 memory.pdf | 2010-10-27 08:01 | 2.2M | |
| 09-Alzheimer.pdf | 2016-11-09 19:07 | 2.2M | |
| bchap-2.pdf | 2008-09-03 16:00 | 2.1M | |
| 5-2 learning.pdf | 2017-10-24 14:45 | 2.1M | |
| 042 sensation.pdf | 2015-10-07 10:55 | 2.0M | |
| bchap-42.pdf | 2014-10-28 19:43 | 2.0M | |
| chapter-21 sensation..> | 2009-09-16 15:30 | 2.0M | |
| bchap-2 neuron.pdf | 2010-09-09 16:18 | 1.8M | |
| 06 movement.pdf | 2016-10-20 10:32 | 1.7M | |
| 01 brain structure.pdf | 2017-09-06 11:57 | 1.6M | |
| bchap-1.pdf | 2008-09-04 08:19 | 1.5M | |
| bchap-6-1 movement.pdf | 2010-10-28 08:02 | 1.5M | |
| chapter-1.pdf | 2009-09-16 15:30 | 1.3M | |
| 6-1 movement.pdf | 2012-11-07 08:45 | 1.1M | |
| chapter-3.pdf | 2009-09-29 08:20 | 1.1M | |
| synapse.pdf | 2010-10-27 08:01 | 1.0M | |
| 07 sleep.pdf | 2016-11-02 19:47 | 751K | |
| 10-Drug abuse.pdf | 2015-11-25 10:32 | 664K | |
| Binocular Rivalry Tu..> | 2019-10-01 14:28 | 579K | |
| bchap-41.pdf | 2008-09-29 17:05 | 554K | |
| bchap-7 sleep.pdf | 2008-10-14 08:31 | 372K | |
| bchap-6 movement.pdf | 2008-10-14 08:31 | 362K | |
| 09-aging.pdf | 2013-11-27 08:02 | 346K | |
| 기억체계이론.pdf | 2010-10-27 08:01 | 271K | |
| fMRI.pdf | 2012-11-26 12:51 | 212K | |
| presentation.pdf | 2008-10-30 19:47 | 93K | |
| plan.htm | 2019-10-01 14:28 | 14K | |
| WS_FTP.LOG | 2004-03-11 22:28 | 5.3K | |
| presentation 2017.htm | 2018-11-13 12:19 | 4.8K | |
| presentation.htm | 2016-12-08 08:19 | 4.6K | |
| slide 2016/ | 2016-12-08 08:18 | - | |
| 諛쒗몴 2016/ | 2016-12-01 08:36 | - | |